C28H32F5NO3 — CID 56664029
9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 56664029) has the molecular formula C28H32F5NO3 and a molecular weight of 525.56 g/mol. Its IUPAC name is 9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | 9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 56664029 |
| Molecular Formula | C28H32F5NO3 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 9-[4-(dimethylamino)phenyl]-5-hydroxy-6-methyl-5-(1,1,2,2,2-pentafluoroethyl)-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | CN(C)c1ccc(C2OCC3(C)C(CCC3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C28H32F5NO3/c1-25-15-37-24(16-4-7-18(8-5-16)34(2)3)23-20-11-9-19(35)14-17(20)6-10-21(23)22(25)12-13-26(25,36)27(29,30)28(31,32)33/h4-5,7-8,14,21-22,24,36H,6,9-13,15H2,1-3H3 |
| InChIKey | ZXXGFBBNJBARSN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|