About 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid
5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid (PubChem CID 56664904) has the molecular formula C22H13ClF3NO2
and a molecular weight of 415.80 g/mol. Its IUPAC name is 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid |
| PubChem CID | 56664904 |
| Molecular Formula | C22H13ClF3NO2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2F)c2cc(Cl)ccc2n1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C22H13ClF3NO2/c23-13-5-8-19-16(10-13)20(15-3-1-2-4-18(15)26)21(22(28)29)27(19)11-12-9-14(24)6-7-17(12)25/h1-10H,11H2,(H,28,29) |
| InChIKey | VDVBSNJXJILGQQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid?
The IUPAC name of 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid (CID 56664904) is 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid?
The canonical SMILES for 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid is O=C(O)c1c(-c2ccccc2F)c2cc(Cl)ccc2n1Cc1cc(F)ccc1F.
What is the InChIKey of 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid?
The InChIKey is VDVBSNJXJILGQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13ClF3NO2/c23-13-5-8-19-16(10-13)20(15-3-1-2-4-18(15)26)21(22(28)29)27(19)11-12-9-14(24)6-7-17(12)25/h1-10H,11H2,(H,28,29).
What are the key properties of 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid?
5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid has a molecular weight of 415.80 g/mol, XLogP of 6.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(2,5-difluorophenyl)methyl]-3-(2-fluorophenyl)indole-2-carboxylic acid is sourced from PubChem (CID 56664904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).