C25H26N4O4 — CID 56664974
(2S)-4-methyl-2-[[4-[6-(phenylcarbamoylamino)-3-pyridinyl]benzoyl]amino]pentanoic acid (PubChem CID 56664974) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is (2S)-4-methyl-2-[[4-[6-(phenylcarbamoylamino)-3-pyridinyl]benzoyl]amino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[[4-[6-(phenylcarbamoylamino)-3-pyridinyl]benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 56664974 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | (2S)-4-methyl-2-[[4-[6-(phenylcarbamoylamino)-3-pyridinyl]benzoyl]amino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ccc(-c2ccc(NC(=O)Nc3ccccc3)nc2)cc1)C(=O)O |
| InChI | InChI=1S/C25H26N4O4/c1-16(2)14-21(24(31)32)28-23(30)18-10-8-17(9-11-18)19-12-13-22(26-15-19)29-25(33)27-20-6-4-3-5-7-20/h3-13,15-16,21H,14H2,1-2H3,(H,28,30)(H,31,32)(H2,26,27,29,33)/t21-/m0/s1 |
| InChIKey | YSBDVLPUESUTGV-NRFANRHFSA-N |
| XLogP | 4.62 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |