C22H24N4O3 — CID 56665096
3-[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 56665096) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 56665096 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrido[2,3-b]pyrazin-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | COc1cc(C#Cc2nc3ncccc3nc2OCCCN(C)C)cc(OC)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-26(2)11-6-12-29-22-20(24-21-19(25-22)7-5-10-23-21)9-8-16-13-17(27-3)15-18(14-16)28-4/h5,7,10,13-15H,6,11-12H2,1-4H3 |
| InChIKey | DIHIWKCMWXAKKV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|