C24H33N5O5 — CID 56665195
(2S)-2-amino-N-[(2R)-1-[[(2S,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propyl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide (PubChem CID 56665195) has the molecular formula C24H33N5O5 and a molecular weight of 471.56 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2R)-1-[[(2S,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propyl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[(2R)-1-[[(2S,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propyl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 56665195 |
| Molecular Formula | C24H33N5O5 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | (2S)-2-amino-N-[(2R)-1-[[(2S,3S)-2-amino-3-hydroxy-3-(4-nitrophenyl)propyl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](Cc1ccccc1)C(=O)NC[C@H](N)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H33N5O5/c1-15(2)12-19(25)23(31)28-21(13-16-6-4-3-5-7-16)24(32)27-14-20(26)22(30)17-8-10-18(11-9-17)29(33)34/h3-11,15,19-22,30H,12-14,25-26H2,1-2H3,(H,27,32)(H,28,31)/t19-,20-,21+,22-/m0/s1 |
| InChIKey | KCLFXHIETYMKKM-KJJMTIBFSA-N |
| XLogP | 1.17 |
| TPSA | 173.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|