C23H34N2O2 — CID 56665269
4-[(5R,6S,9S,13S)-7-[(4-methylphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 56665269) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-[(5R,6S,9S,13S)-7-[(4-methylphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5R,6S,9S,13S)-7-[(4-methylphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 56665269 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 4-[(5R,6S,9S,13S)-7-[(4-methylphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | Cc1ccc(CN2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@@H]2CCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H34N2O2/c1-17-9-11-18(12-10-17)15-25-16-19-5-3-13-24-14-4-6-20(23(19)24)21(25)7-2-8-22(26)27/h9-12,19-21,23H,2-8,13-16H2,1H3,(H,26,27)/t19-,20+,21-,23-/m0/s1 |
| InChIKey | ATBWUGYOGQNNNN-KGSLCBSSSA-N |
| XLogP | 3.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |