C19H19N3O2S — CID 56665388
6,7-dimethoxy-3-phenyl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide (PubChem CID 56665388) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 6,7-dimethoxy-3-phenyl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide.
| Compound Name | 6,7-dimethoxy-3-phenyl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 56665388 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 6,7-dimethoxy-3-phenyl-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C1=NN(C(N)=S)C(c3ccccc3)C1C2 |
| InChI | InChI=1S/C19H19N3O2S/c1-23-15-9-12-8-14-17(13(12)10-16(15)24-2)21-22(19(20)25)18(14)11-6-4-3-5-7-11/h3-7,9-10,14,18H,8H2,1-2H3,(H2,20,25) |
| InChIKey | DGYQFSRCYSJUTM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|