About N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide
N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide (PubChem CID 56665651) has the molecular formula C25H24N2O6S
and a molecular weight of 480.54 g/mol. Its IUPAC name is N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide |
| PubChem CID | 56665651 |
| Molecular Formula | C25H24N2O6S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide |
| SMILES | COc1c(CN(c2ccccc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C25H24N2O6S/c1-25(2)16-15-18-9-10-19(23(32-3)24(18)33-25)17-26(20-7-5-4-6-8-20)34(30,31)22-13-11-21(12-14-22)27(28)29/h4-16H,17H2,1-3H3 |
| InChIKey | NWCVQUUFCSEPNI-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide?
The IUPAC name of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide (CID 56665651) is N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide.
What is the SMILES notation for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide?
The canonical SMILES for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide is COc1c(CN(c2ccccc2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)ccc2c1OC(C)(C)C=C2.
What is the InChIKey of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide?
The InChIKey is NWCVQUUFCSEPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O6S/c1-25(2)16-15-18-9-10-19(23(32-3)24(18)33-25)17-26(20-7-5-4-6-8-20)34(30,31)22-13-11-21(12-14-22)27(28)29/h4-16H,17H2,1-3H3.
What are the key properties of N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide?
N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide has a molecular weight of 480.54 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(8-methoxy-2,2-dimethylchromen-7-yl)methyl]-4-nitro-N-phenylbenzenesulfonamide is sourced from PubChem (CID 56665651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).