C16H10F4N4O2 — CID 56666013
(NZ)-N-[(4-methylimidazol-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 56666013) has the molecular formula C16H10F4N4O2 and a molecular weight of 366.27 g/mol. Its IUPAC name is (NZ)-N-[(4-methylimidazol-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4-methylimidazol-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56666013 |
| Molecular Formula | C16H10F4N4O2 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | (NZ)-N-[(4-methylimidazol-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | Cc1cn(/C(=N\O)c2ccc(Oc3c(F)c(F)cc(F)c3F)nc2)cn1 |
| InChI | InChI=1S/C16H10F4N4O2/c1-8-6-24(7-22-8)16(23-25)9-2-3-12(21-5-9)26-15-13(19)10(17)4-11(18)14(15)20/h2-7,25H,1H3/b23-16- |
| InChIKey | SVJMSRMSWOZEID-KQWNVCNZSA-N |
| XLogP | 3.62 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|