C22H20N4Se2 — CID 56666224
(4S)-4-[(R)-[4-(4-methylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole (PubChem CID 56666224) has the molecular formula C22H20N4Se2 and a molecular weight of 498.35 g/mol. Its IUPAC name is (4S)-4-[(R)-[4-(4-methylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole.
| Compound Name | (4S)-4-[(R)-[4-(4-methylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
|---|---|
| PubChem CID | 56666224 |
| Molecular Formula | C22H20N4Se2 |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 500.00 |
| IUPAC Name | (4S)-4-[(R)-[4-(4-methylphenyl)selenadiazol-5-yl]-phenylmethyl]-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazole |
| SMILES | Cc1ccc(-c2nn[se]c2[C@@H](c2ccccc2)[C@@H]2CCCc3[se]nnc32)cc1 |
| InChI | InChI=1S/C22H20N4Se2/c1-14-10-12-16(13-11-14)20-22(28-26-23-20)19(15-6-3-2-4-7-15)17-8-5-9-18-21(17)24-25-27-18/h2-4,6-7,10-13,17,19H,5,8-9H2,1H3/t17-,19-/m0/s1 |
| InChIKey | LQCBYVIDCLWBLM-HKUYNNGSSA-N |
| XLogP | 3.61 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|