About 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine
9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine (PubChem CID 56666355) has the molecular formula C12H12ClN5O2
and a molecular weight of 293.71 g/mol. Its IUPAC name is 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine.
Molecular Properties
| Compound Name | 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine |
| PubChem CID | 56666355 |
| Molecular Formula | C12H12ClN5O2 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine |
| SMILES | O=[N+]([O-])c1nc(Cl)c2ncn([C@@H]3C[C@H]4CC[C@@H]3C4)c2n1 |
| InChI | InChI=1S/C12H12ClN5O2/c13-10-9-11(16-12(15-10)18(19)20)17(5-14-9)8-4-6-1-2-7(8)3-6/h5-8H,1-4H2/t6-,7+,8+/m0/s1 |
| InChIKey | JIRYOXVXWXPDMJ-XLPZGREQSA-N |
| XLogP | 2.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine?
The IUPAC name of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine (CID 56666355) is 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine.
What is the SMILES notation for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine?
The canonical SMILES for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine is O=[N+]([O-])c1nc(Cl)c2ncn([C@@H]3C[C@H]4CC[C@@H]3C4)c2n1.
What is the InChIKey of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine?
The InChIKey is JIRYOXVXWXPDMJ-XLPZGREQSA-N. The full InChI is InChI=1S/C12H12ClN5O2/c13-10-9-11(16-12(15-10)18(19)20)17(5-14-9)8-4-6-1-2-7(8)3-6/h5-8H,1-4H2/t6-,7+,8+/m0/s1.
What are the key properties of 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine?
9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine has a molecular weight of 293.71 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-6-chloro-2-nitropurine is sourced from PubChem (CID 56666355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).