C14H19BrN2 — CID 56666440
2-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide (PubChem CID 56666440) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide.
| Compound Name | 2-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide |
|---|---|
| PubChem CID | 56666440 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-benzyl-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-2-ium bromide |
| SMILES | C1=[N+](Cc2ccccc2)CC2CCCCN12.[Br-] |
| InChI | InChI=1S/C14H19N2.BrH/c1-2-6-13(7-3-1)10-15-11-14-8-4-5-9-16(14)12-15;/h1-3,6-7,12,14H,4-5,8-11H2;1H/q+1;/p-1 |
| InChIKey | VXXXXITXNRJZMT-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|