C26H37ClN6O3S — CID 56666621
N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]cyclopropanesulfonamide (PubChem CID 56666621) has the molecular formula C26H37ClN6O3S and a molecular weight of 549.14 g/mol. Its IUPAC name is N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]cyclopropanesulfonamide.
| Compound Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 56666621 |
| Molecular Formula | C26H37ClN6O3S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | N-[(1R,2R)-2-[[5-chloro-2-[[3-(2-methoxyethyl)-1,2,4,5-tetrahydro-3-benzazepin-7-yl]amino]pyrimidin-4-yl]amino]cyclohexyl]cyclopropanesulfonamide |
| SMILES | COCCN1CCc2ccc(Nc3ncc(Cl)c(N[C@@H]4CCCC[C@H]4NS(=O)(=O)C4CC4)n3)cc2CC1 |
| InChI | InChI=1S/C26H37ClN6O3S/c1-36-15-14-33-12-10-18-6-7-20(16-19(18)11-13-33)29-26-28-17-22(27)25(31-26)30-23-4-2-3-5-24(23)32-37(34,35)21-8-9-21/h6-7,16-17,21,23-24,32H,2-5,8-15H2,1H3,(H2,28,29,30,31)/t23-,24-/m1/s1 |
| InChIKey | VCDZNTKQCSUNQC-DNQXCXABSA-N |
| XLogP | 3.73 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |