C24H27N5O2S2 — CID 56666643
4-pentyl-N-[2-(3-pyrazin-2-yl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide (PubChem CID 56666643) has the molecular formula C24H27N5O2S2 and a molecular weight of 481.65 g/mol. Its IUPAC name is 4-pentyl-N-[2-(3-pyrazin-2-yl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-pentyl-N-[2-(3-pyrazin-2-yl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56666643 |
| Molecular Formula | C24H27N5O2S2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 4-pentyl-N-[2-(3-pyrazin-2-yl-5-thiophen-2-yl-1H-pyrazol-4-yl)ethyl]benzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3cnccn3)n[nH]c2-c2cccs2)cc1 |
| InChI | InChI=1S/C24H27N5O2S2/c1-2-3-4-6-18-8-10-19(11-9-18)33(30,31)27-13-12-20-23(21-17-25-14-15-26-21)28-29-24(20)22-7-5-16-32-22/h5,7-11,14-17,27H,2-4,6,12-13H2,1H3,(H,28,29) |
| InChIKey | HWMBQCSPTRZEOP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|