C21H28O6S — CID 56666748
(2R,3R,4S,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-3-methoxy-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56666748) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-3-methoxy-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-3-methoxy-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56666748 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-[(4-ethylphenyl)methyl]-3-methoxy-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2sc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)c2C)cc1 |
| InChI | InChI=1S/C21H28O6S/c1-4-12-5-7-13(8-6-12)9-15-11(2)19(26-3)21(28-15)20-18(25)17(24)16(23)14(10-22)27-20/h5-8,14,16-18,20,22-25H,4,9-10H2,1-3H3/t14-,16-,17+,18-,20-/m1/s1 |
| InChIKey | VJEOLZFQMIWUEA-UVNCQSPWSA-N |
| XLogP | 1.73 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |