About 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one
2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one (PubChem CID 56666783) has the molecular formula C19H18FN3O2
and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one |
| PubChem CID | 56666783 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one |
| SMILES | Cc1cc(C)c(Oc2ccc(=O)n(Nc3ccc(F)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C19H18FN3O2/c1-12-10-13(2)19(14(3)11-12)25-17-8-9-18(24)23(22-17)21-16-6-4-15(20)5-7-16/h4-11,21H,1-3H3 |
| InChIKey | NSPQWCSTQKGQGA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one?
The IUPAC name of 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one (CID 56666783) is 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one.
What is the SMILES notation for 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one?
The canonical SMILES for 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one is Cc1cc(C)c(Oc2ccc(=O)n(Nc3ccc(F)cc3)n2)c(C)c1.
What is the InChIKey of 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one?
The InChIKey is NSPQWCSTQKGQGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18FN3O2/c1-12-10-13(2)19(14(3)11-12)25-17-8-9-18(24)23(22-17)21-16-6-4-15(20)5-7-16/h4-11,21H,1-3H3.
What are the key properties of 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one?
2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one has a molecular weight of 339.37 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoroanilino)-6-(2,4,6-trimethylphenoxy)pyridazin-3-one is sourced from PubChem (CID 56666783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).