C19H18N4OS — CID 56666813
1-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propan-2-one (PubChem CID 56666813) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propan-2-one.
| Compound Name | 1-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propan-2-one |
|---|---|
| PubChem CID | 56666813 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[3-[12-methyl-8-(methylamino)-3-thia-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-4-yl]phenyl]propan-2-one |
| SMILES | CNc1nc2cc(-c3cccc(CC(C)=O)c3)sc2n2c(C)cnc12 |
| InChI | InChI=1S/C19H18N4OS/c1-11-10-21-18-17(20-3)22-15-9-16(25-19(15)23(11)18)14-6-4-5-13(8-14)7-12(2)24/h4-6,8-10H,7H2,1-3H3,(H,20,22) |
| InChIKey | OSOBQJBIJAHMTO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |