C12H10ClN2NaO4S — CID 56667020
sodium 4-[[2-(2-chloroethyl)-3,5-dioxo-1,2,4-thiadiazolidin-4-yl]methyl]benzoate (PubChem CID 56667020) has the molecular formula C12H10ClN2NaO4S and a molecular weight of 336.73 g/mol. Its IUPAC name is sodium 4-[[2-(2-chloroethyl)-3,5-dioxo-1,2,4-thiadiazolidin-4-yl]methyl]benzoate.
| Compound Name | sodium 4-[[2-(2-chloroethyl)-3,5-dioxo-1,2,4-thiadiazolidin-4-yl]methyl]benzoate |
|---|---|
| PubChem CID | 56667020 |
| Molecular Formula | C12H10ClN2NaO4S |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | sodium 4-[[2-(2-chloroethyl)-3,5-dioxo-1,2,4-thiadiazolidin-4-yl]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(Cn2c(=O)sn(CCCl)c2=O)cc1.[Na+] |
| InChI | InChI=1S/C12H11ClN2O4S.Na/c13-5-6-15-11(18)14(12(19)20-15)7-8-1-3-9(4-2-8)10(16)17;/h1-4H,5-7H2,(H,16,17);/q;+1/p-1 |
| InChIKey | PKRCHEHMDDGLLJ-UHFFFAOYSA-M |
| XLogP | -3.27 |
| TPSA | 84.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|