C17H28O4 — CID 56667024
(3E,6S,16R)-6-methoxy-16-methyl-1-oxacyclohexadec-3-ene-2,5-dione (PubChem CID 56667024) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3E,6S,16R)-6-methoxy-16-methyl-1-oxacyclohexadec-3-ene-2,5-dione.
| Compound Name | (3E,6S,16R)-6-methoxy-16-methyl-1-oxacyclohexadec-3-ene-2,5-dione |
|---|---|
| PubChem CID | 56667024 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | (3E,6S,16R)-6-methoxy-16-methyl-1-oxacyclohexadec-3-ene-2,5-dione |
| SMILES | CO[C@H]1CCCCCCCCC[C@@H](C)OC(=O)/C=C/C1=O |
| InChI | InChI=1S/C17H28O4/c1-14-10-8-6-4-3-5-7-9-11-16(20-2)15(18)12-13-17(19)21-14/h12-14,16H,3-11H2,1-2H3/b13-12+/t14-,16+/m1/s1 |
| InChIKey | DKDFGCPSHOZKHJ-JIXSRCLSSA-N |
| XLogP | 3.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |