About cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione
cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione (PubChem CID 56667025) has the molecular formula C17H30O4
and a molecular weight of 298.42 g/mol. Its IUPAC name is cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione.
Molecular Properties
| Compound Name | cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione |
| PubChem CID | 56667025 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione |
| SMILES | CO[C@H]1CCCCCCCCC[C@@H](C)OC(=O)CCC1=O |
| InChI | InChI=1S/C17H30O4/c1-14-10-8-6-4-3-5-7-9-11-16(20-2)15(18)12-13-17(19)21-14/h14,16H,3-13H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | GEKUXTCJYNJEIY-ZBFHGGJFSA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione?
The IUPAC name of cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione (CID 56667025) is cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione.
What is the SMILES notation for cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione?
The canonical SMILES for cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione is CO[C@H]1CCCCCCCCC[C@@H](C)OC(=O)CCC1=O.
What is the InChIKey of cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione?
The InChIKey is GEKUXTCJYNJEIY-ZBFHGGJFSA-N. The full InChI is InChI=1S/C17H30O4/c1-14-10-8-6-4-3-5-7-9-11-16(20-2)15(18)12-13-17(19)21-14/h14,16H,3-13H2,1-2H3/t14-,16+/m1/s1.
What are the key properties of cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione?
cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione has a molecular weight of 298.42 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(6S,16R)-6-methoxy-16-methyl-oxacyclohexadecane-2,5-dione is sourced from PubChem (CID 56667025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).