C34H43N7O — CID 56667686
[[4-[2-[3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-morpholin-4-ylmethylidene]cyanamide (PubChem CID 56667686) has the molecular formula C34H43N7O and a molecular weight of 565.77 g/mol. Its IUPAC name is [[4-[2-[3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-morpholin-4-ylmethylidene]cyanamide.
| Compound Name | [[4-[2-[3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-morpholin-4-ylmethylidene]cyanamide |
|---|---|
| PubChem CID | 56667686 |
| Molecular Formula | C34H43N7O |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | [[4-[2-[3-(2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]ethyl]-4-phenylpiperidin-1-yl]-morpholin-4-ylmethylidene]cyanamide |
| SMILES | Cc1nc2ccccc2n1C1CC2CCC(C1)N2CCC1(c2ccccc2)CCN(/C(=N/C#N)N2CCOCC2)CC1 |
| InChI | InChI=1S/C34H43N7O/c1-26-37-31-9-5-6-10-32(31)41(26)30-23-28-11-12-29(24-30)40(28)18-15-34(27-7-3-2-4-8-27)13-16-38(17-14-34)33(36-25-35)39-19-21-42-22-20-39/h2-10,28-30H,11-24H2,1H3/b36-33- |
| InChIKey | NQXSIRJUWDUUDB-NECWGFRUSA-N |
| XLogP | 5.11 |
| TPSA | 72.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|