About 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile
4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 56668298) has the molecular formula C18H12F2N4O
and a molecular weight of 338.32 g/mol. Its IUPAC name is 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile.
Molecular Properties
| Compound Name | 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile |
| PubChem CID | 56668298 |
| Molecular Formula | C18H12F2N4O |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(C(O)c3cc(F)ccc3F)n2)cc1 |
| InChI | InChI=1S/C18H12F2N4O/c19-12-3-6-15(20)14(9-12)17(25)16-7-8-22-18(24-16)23-13-4-1-11(10-21)2-5-13/h1-9,17,25H,(H,22,23,24) |
| InChIKey | AYOXCDHCHKYZBP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile?
The IUPAC name of 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile (CID 56668298) is 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile.
What is the SMILES notation for 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile?
The canonical SMILES for 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile is N#Cc1ccc(Nc2nccc(C(O)c3cc(F)ccc3F)n2)cc1.
What is the InChIKey of 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile?
The InChIKey is AYOXCDHCHKYZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F2N4O/c19-12-3-6-15(20)14(9-12)17(25)16-7-8-22-18(24-16)23-13-4-1-11(10-21)2-5-13/h1-9,17,25H,(H,22,23,24).
What are the key properties of 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile?
4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile has a molecular weight of 338.32 g/mol, XLogP of 3.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[(2,5-difluorophenyl)-hydroxymethyl]pyrimidin-2-yl]amino]benzonitrile is sourced from PubChem (CID 56668298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).