C22H26N4O2 — CID 56668337
2-(1,4-diazepan-1-ylmethyl)-3-(2-ethoxyphenyl)quinazolin-4-one (PubChem CID 56668337) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-ylmethyl)-3-(2-ethoxyphenyl)quinazolin-4-one.
| Compound Name | 2-(1,4-diazepan-1-ylmethyl)-3-(2-ethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 56668337 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-(1,4-diazepan-1-ylmethyl)-3-(2-ethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccccc1-n1c(CN2CCCNCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H26N4O2/c1-2-28-20-11-6-5-10-19(20)26-21(16-25-14-7-12-23-13-15-25)24-18-9-4-3-8-17(18)22(26)27/h3-6,8-11,23H,2,7,12-16H2,1H3 |
| InChIKey | KQKLUZQUFDIROG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |