C19H18N4O2 — CID 56668432
(E)-3-(3,4-dimethoxyphenyl)-2-(5,6-dimethylbenzotriazol-2-yl)prop-2-enenitrile (PubChem CID 56668432) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-2-(5,6-dimethylbenzotriazol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-2-(5,6-dimethylbenzotriazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 56668432 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-2-(5,6-dimethylbenzotriazol-2-yl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)n2nc3cc(C)c(C)cc3n2)cc1OC |
| InChI | InChI=1S/C19H18N4O2/c1-12-7-16-17(8-13(12)2)22-23(21-16)15(11-20)9-14-5-6-18(24-3)19(10-14)25-4/h5-10H,1-4H3/b15-9+ |
| InChIKey | WOZDNMDGWZKZKE-OQLLNIDSSA-N |
| XLogP | 3.59 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|