About N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline
N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline (PubChem CID 56668954) has the molecular formula C19H17Cl2NO
and a molecular weight of 346.26 g/mol. Its IUPAC name is N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline.
Molecular Properties
| Compound Name | N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline |
| PubChem CID | 56668954 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NCc1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C19H17Cl2NO/c1-12-4-3-5-13(2)19(12)22-11-15-7-9-18(23-15)16-10-14(20)6-8-17(16)21/h3-10,22H,11H2,1-2H3 |
| InChIKey | CETWTOZRMPCTFO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline?
The IUPAC name of N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline (CID 56668954) is N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline.
What is the SMILES notation for N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline?
The canonical SMILES for N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline is Cc1cccc(C)c1NCc1ccc(-c2cc(Cl)ccc2Cl)o1.
What is the InChIKey of N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline?
The InChIKey is CETWTOZRMPCTFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2NO/c1-12-4-3-5-13(2)19(12)22-11-15-7-9-18(23-15)16-10-14(20)6-8-17(16)21/h3-10,22H,11H2,1-2H3.
What are the key properties of N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline?
N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline has a molecular weight of 346.26 g/mol, XLogP of 6.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(2,5-dichlorophenyl)furan-2-yl]methyl]-2,6-dimethylaniline is sourced from PubChem (CID 56668954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).