C24H23ClFN3O2 — CID 56669166
Benzyl 4-[(4-chloro-2-fluorophenyl)-pyridin-3-ylmethyl]piperazine-1-carboxylate (PubChem CID 56669166) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.90 g/mol. Its IUPAC name is benzyl 4-[(4-chloro-2-fluorophenyl)-pyridin-3-ylmethyl]piperazine-1-carboxylate.
| Compound Name | Benzyl 4-[(4-chloro-2-fluorophenyl)-pyridin-3-ylmethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 56669166 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | benzyl 4-[(4-chloro-2-fluorophenyl)-pyridin-3-ylmethyl]piperazine-1-carboxylate |
| SMILES | C1CN(CCN1C(C2=CN=CC=C2)C3=C(C=C(C=C3)Cl)F)C(=O)OCC4=CC=CC=C4 |
| InChI | InChI=1S/C24H23ClFN3O2/c25-20-8-9-21(22(26)15-20)23(19-7-4-10-27-16-19)28-11-13-29(14-12-28)24(30)31-17-18-5-2-1-3-6-18/h1-10,15-16,23H,11-14,17H2 |
| InChIKey | IRKJDSRSACUILA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 45.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | 569 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |