C25H22F3N3O — CID 56669191
2-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]oxybenzonitrile (PubChem CID 56669191) has the molecular formula C25H22F3N3O and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]oxybenzonitrile.
| Compound Name | 2-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]oxybenzonitrile |
|---|---|
| PubChem CID | 56669191 |
| Molecular Formula | C25H22F3N3O |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 2-[1-[pyridin-3-yl-[4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]oxybenzonitrile |
| SMILES | N#Cc1ccccc1OC1CCN(C(c2ccc(C(F)(F)F)cc2)c2cccnc2)CC1 |
| InChI | InChI=1S/C25H22F3N3O/c26-25(27,28)21-9-7-18(8-10-21)24(20-5-3-13-30-17-20)31-14-11-22(12-15-31)32-23-6-2-1-4-19(23)16-29/h1-10,13,17,22,24H,11-12,14-15H2 |
| InChIKey | DITBHDFXZUXJCA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |