C16H17F3N6O2 — CID 56669245
4-amino-1-[[2-(2-methoxyethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridin-2-one (PubChem CID 56669245) has the molecular formula C16H17F3N6O2 and a molecular weight of 382.35 g/mol. Its IUPAC name is 4-amino-1-[[2-(2-methoxyethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridin-2-one.
| Compound Name | 4-amino-1-[[2-(2-methoxyethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 56669245 |
| Molecular Formula | C16H17F3N6O2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-amino-1-[[2-(2-methoxyethylamino)-3-pyridinyl]methyl]-6-(trifluoromethyl)-3H-imidazo[4,5-c]pyridin-2-one |
| SMILES | COCCNc1ncccc1Cn1c(=O)[nH]c2c(N)nc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H17F3N6O2/c1-27-6-5-22-14-9(3-2-4-21-14)8-25-10-7-11(16(17,18)19)23-13(20)12(10)24-15(25)26/h2-4,7H,5-6,8H2,1H3,(H2,20,23)(H,21,22)(H,24,26) |
| InChIKey | RAJSJXBZDGSFRG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|