C23H25N3O2 — CID 56669279
N-(cyclopropylmethyl)-N'-hydroxy-6-naphthalen-2-yloxy-N-propylpyridine-3-carboximidamide (PubChem CID 56669279) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-hydroxy-6-naphthalen-2-yloxy-N-propylpyridine-3-carboximidamide.
| Compound Name | N-(cyclopropylmethyl)-N'-hydroxy-6-naphthalen-2-yloxy-N-propylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 56669279 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-hydroxy-6-naphthalen-2-yloxy-N-propylpyridine-3-carboximidamide |
| SMILES | CCCN(CC1CC1)/C(=N\O)c1ccc(Oc2ccc3ccccc3c2)nc1 |
| InChI | InChI=1S/C23H25N3O2/c1-2-13-26(16-17-7-8-17)23(25-27)20-10-12-22(24-15-20)28-21-11-9-18-5-3-4-6-19(18)14-21/h3-6,9-12,14-15,17,27H,2,7-8,13,16H2,1H3/b25-23- |
| InChIKey | LHIKUNLNNUPGNY-BZZOAKBMSA-N |
| XLogP | 5.28 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|