C23H27N3O4 — CID 56669455
(E)-but-2-enedioic acid;N,N-dimethyl-1-(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methanamine (PubChem CID 56669455) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N,N-dimethyl-1-(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methanamine.
| Compound Name | (E)-but-2-enedioic acid;N,N-dimethyl-1-(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methanamine |
|---|---|
| PubChem CID | 56669455 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (E)-but-2-enedioic acid;N,N-dimethyl-1-(2-methyl-5-phenyl-1,5-dihydro-2,4-benzodiazepin-3-yl)methanamine |
| SMILES | CN(C)CC1=NC(c2ccccc2)c2ccccc2CN1C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H23N3.C4H4O4/c1-21(2)14-18-20-19(15-9-5-4-6-10-15)17-12-8-7-11-16(17)13-22(18)3;5-3(6)1-2-4(7)8/h4-12,19H,13-14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CYYSYUFJYLYPLA-WLHGVMLRSA-N |
| XLogP | 2.89 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|