About 7-phenylquinazoline-2,4-diamine
7-phenylquinazoline-2,4-diamine (PubChem CID 56669623) has the molecular formula C14H12N4
and a molecular weight of 236.28 g/mol. Its IUPAC name is 7-phenylquinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 7-phenylquinazoline-2,4-diamine |
| PubChem CID | 56669623 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 7-phenylquinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2ccc(-c3ccccc3)cc2n1 |
| InChI | InChI=1S/C14H12N4/c15-13-11-7-6-10(9-4-2-1-3-5-9)8-12(11)17-14(16)18-13/h1-8H,(H4,15,16,17,18) |
| InChIKey | VQOBXMVKFHMZJP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-phenylquinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenylquinazoline-2,4-diamine?
The IUPAC name of 7-phenylquinazoline-2,4-diamine (CID 56669623) is 7-phenylquinazoline-2,4-diamine.
What is the SMILES notation for 7-phenylquinazoline-2,4-diamine?
The canonical SMILES for 7-phenylquinazoline-2,4-diamine is Nc1nc(N)c2ccc(-c3ccccc3)cc2n1.
What is the InChIKey of 7-phenylquinazoline-2,4-diamine?
The InChIKey is VQOBXMVKFHMZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4/c15-13-11-7-6-10(9-4-2-1-3-5-9)8-12(11)17-14(16)18-13/h1-8H,(H4,15,16,17,18).
What are the key properties of 7-phenylquinazoline-2,4-diamine?
7-phenylquinazoline-2,4-diamine has a molecular weight of 236.28 g/mol, XLogP of 2.46, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenylquinazoline-2,4-diamine is sourced from PubChem (CID 56669623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).