About N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine
N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine (PubChem CID 56669697) has the molecular formula C17H16N2O4
and a molecular weight of 312.33 g/mol. Its IUPAC name is N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine |
| PubChem CID | 56669697 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine |
| SMILES | CCN(Cc1coc(-c2ccco2)n1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16N2O4/c1-2-19(13-5-6-14-16(8-13)23-11-22-14)9-12-10-21-17(18-12)15-4-3-7-20-15/h3-8,10H,2,9,11H2,1H3 |
| InChIKey | MHXNSJPRCAKFFF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine?
The IUPAC name of N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine (CID 56669697) is N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine.
What is the SMILES notation for N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine?
The canonical SMILES for N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine is CCN(Cc1coc(-c2ccco2)n1)c1ccc2c(c1)OCO2.
What is the InChIKey of N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine?
The InChIKey is MHXNSJPRCAKFFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O4/c1-2-19(13-5-6-14-16(8-13)23-11-22-14)9-12-10-21-17(18-12)15-4-3-7-20-15/h3-8,10H,2,9,11H2,1H3.
What are the key properties of N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine?
N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine has a molecular weight of 312.33 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[[2-(furan-2-yl)-1,3-oxazol-4-yl]methyl]-1,3-benzodioxol-5-amine is sourced from PubChem (CID 56669697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).