C22H26N4O4+2 — CID 56669738
trimethyl-[[5,7,12,14-tetraoxo-13-[(trimethylazaniumyl)methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl]azanium (PubChem CID 56669738) has the molecular formula C22H26N4O4+2 and a molecular weight of 410.47 g/mol. Its IUPAC name is trimethyl-[[5,7,12,14-tetraoxo-13-[(trimethylazaniumyl)methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl]azanium.
| Compound Name | trimethyl-[[5,7,12,14-tetraoxo-13-[(trimethylazaniumyl)methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl]azanium |
|---|---|
| PubChem CID | 56669738 |
| Molecular Formula | C22H26N4O4+2 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | trimethyl-[[5,7,12,14-tetraoxo-13-[(trimethylazaniumyl)methyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl]methyl]azanium |
| SMILES | C[N+](C)(C)CN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(C[N+](C)(C)C)C3=O |
| InChI | InChI=1S/C22H26N4O4/c1-25(2,3)11-23-19(27)13-7-9-15-18-16(10-8-14(17(13)18)20(23)28)22(30)24(21(15)29)12-26(4,5)6/h7-10H,11-12H2,1-6H3/q+2 |
| InChIKey | QRLXPVBTBCFNEK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|