C23H33NO — CID 56669812
(2E,4E,6E,8E)-N-cyclopropyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 56669812) has the molecular formula C23H33NO and a molecular weight of 339.52 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-cyclopropyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-cyclopropyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 56669812 |
| Molecular Formula | C23H33NO |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | (2E,4E,6E,8E)-N-cyclopropyl-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NC2CC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C23H33NO/c1-17(11-14-21-19(3)10-7-15-23(21,4)5)8-6-9-18(2)16-22(25)24-20-12-13-20/h6,8-9,11,14,16,20H,7,10,12-13,15H2,1-5H3,(H,24,25)/b9-6+,14-11+,17-8+,18-16+ |
| InChIKey | MCMIFAUNRYQKLN-IMLUBWEFSA-N |
| XLogP | 5.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|