About 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine
2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine (PubChem CID 56669827) has the molecular formula C19H24N6O
and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine |
| PubChem CID | 56669827 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine |
| SMILES | CCOc1ccc(-n2nc3c(N4CCNCC4)nnc(C)c3c2C)cc1 |
| InChI | InChI=1S/C19H24N6O/c1-4-26-16-7-5-15(6-8-16)25-14(3)17-13(2)21-22-19(18(17)23-25)24-11-9-20-10-12-24/h5-8,20H,4,9-12H2,1-3H3 |
| InChIKey | JKAOGJXEFQNYHE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The IUPAC name of 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine (CID 56669827) is 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine.
What is the SMILES notation for 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The canonical SMILES for 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine is CCOc1ccc(-n2nc3c(N4CCNCC4)nnc(C)c3c2C)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The InChIKey is JKAOGJXEFQNYHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N6O/c1-4-26-16-7-5-15(6-8-16)25-14(3)17-13(2)21-22-19(18(17)23-25)24-11-9-20-10-12-24/h5-8,20H,4,9-12H2,1-3H3.
What are the key properties of 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine has a molecular weight of 352.44 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine is sourced from PubChem (CID 56669827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).