C39H34N6O2 — CID 56669908
4-[2-methyl-4-[2-oxo-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-1-yl]phenyl]-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 56669908) has the molecular formula C39H34N6O2 and a molecular weight of 618.74 g/mol. Its IUPAC name is 4-[2-methyl-4-[2-oxo-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-1-yl]phenyl]-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 4-[2-methyl-4-[2-oxo-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-1-yl]phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 56669908 |
| Molecular Formula | C39H34N6O2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 4-[2-methyl-4-[2-oxo-9-(1H-pyrrolo[2,3-b]pyridin-5-yl)benzo[h][1,6]naphthyridin-1-yl]phenyl]-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | Cc1cc(-n2c(=O)ccc3cnc4ccc(-c5cnc6[nH]ccc6c5)cc4c32)ccc1-c1ccc(C(=O)NC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C39H34N6O2/c1-24-19-32(9-10-33(24)25-3-5-26(6-4-25)39(47)43-31-14-17-44(2)18-15-31)45-36(46)12-8-29-22-41-35-11-7-27(21-34(35)37(29)45)30-20-28-13-16-40-38(28)42-23-30/h3-13,16,19-23,31H,14-15,17-18H2,1-2H3,(H,40,42)(H,43,47) |
| InChIKey | MZOSYRNVTPEWRZ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|