C23H19Cl2NO — CID 56669929
(2S,3R,6R)-2,6-bis(2-chlorophenyl)-3-phenylpiperidin-4-one (PubChem CID 56669929) has the molecular formula C23H19Cl2NO and a molecular weight of 396.32 g/mol. Its IUPAC name is (2S,3R,6R)-2,6-bis(2-chlorophenyl)-3-phenylpiperidin-4-one.
| Compound Name | (2S,3R,6R)-2,6-bis(2-chlorophenyl)-3-phenylpiperidin-4-one |
|---|---|
| PubChem CID | 56669929 |
| Molecular Formula | C23H19Cl2NO |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (2S,3R,6R)-2,6-bis(2-chlorophenyl)-3-phenylpiperidin-4-one |
| SMILES | O=C1C[C@H](c2ccccc2Cl)N[C@H](c2ccccc2Cl)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H19Cl2NO/c24-18-12-6-4-10-16(18)20-14-21(27)22(15-8-2-1-3-9-15)23(26-20)17-11-5-7-13-19(17)25/h1-13,20,22-23,26H,14H2/t20-,22+,23-/m1/s1 |
| InChIKey | GWJJGMOJSVFXKN-AKIFATBCSA-N |
| XLogP | 6.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |