C15H19BO5 — CID 56669983
(1S,2R,6R,8R)-4,4-dimethyl-11-(4-methylphenyl)-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane (PubChem CID 56669983) has the molecular formula C15H19BO5 and a molecular weight of 290.12 g/mol. Its IUPAC name is (1S,2R,6R,8R)-4,4-dimethyl-11-(4-methylphenyl)-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R)-4,4-dimethyl-11-(4-methylphenyl)-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane |
|---|---|
| PubChem CID | 56669983 |
| Molecular Formula | C15H19BO5 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (1S,2R,6R,8R)-4,4-dimethyl-11-(4-methylphenyl)-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecane |
| SMILES | Cc1ccc(B2OC[C@H]3O[C@@H]4OC(C)(C)O[C@@H]4[C@H]3O2)cc1 |
| InChI | InChI=1S/C15H19BO5/c1-9-4-6-10(7-5-9)16-17-8-11-12(21-16)13-14(18-11)20-15(2,3)19-13/h4-7,11-14H,8H2,1-3H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | SSILQPMEURZOJE-XJFOESAGSA-N |
| XLogP | 0.98 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|