C22H30O5S — CID 56670174
(2R,3R,4S,5S,6R)-2-[5-[(4-tert-butylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56670174) has the molecular formula C22H30O5S and a molecular weight of 406.54 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-[(4-tert-butylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-[(4-tert-butylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56670174 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-[(4-tert-butylphenyl)methyl]-4-methylthiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1cc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)sc1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H30O5S/c1-12-9-17(21-20(26)19(25)18(24)15(11-23)27-21)28-16(12)10-13-5-7-14(8-6-13)22(2,3)4/h5-9,15,18-21,23-26H,10-11H2,1-4H3/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | JRMIAXVGZDIABG-GRARQNNCSA-N |
| XLogP | 2.46 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |