About 1,5-dianilinopyridin-2-one
1,5-dianilinopyridin-2-one (PubChem CID 56670211) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is 1,5-dianilinopyridin-2-one.
Molecular Properties
| Compound Name | 1,5-dianilinopyridin-2-one |
| PubChem CID | 56670211 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1,5-dianilinopyridin-2-one |
| SMILES | O=c1ccc(Nc2ccccc2)cn1Nc1ccccc1 |
| InChI | InChI=1S/C17H15N3O/c21-17-12-11-16(18-14-7-3-1-4-8-14)13-20(17)19-15-9-5-2-6-10-15/h1-13,18-19H |
| InChIKey | MNBQAXYPRZBHBK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dianilinopyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dianilinopyridin-2-one?
The IUPAC name of 1,5-dianilinopyridin-2-one (CID 56670211) is 1,5-dianilinopyridin-2-one.
What is the SMILES notation for 1,5-dianilinopyridin-2-one?
The canonical SMILES for 1,5-dianilinopyridin-2-one is O=c1ccc(Nc2ccccc2)cn1Nc1ccccc1.
What is the InChIKey of 1,5-dianilinopyridin-2-one?
The InChIKey is MNBQAXYPRZBHBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c21-17-12-11-16(18-14-7-3-1-4-8-14)13-20(17)19-15-9-5-2-6-10-15/h1-13,18-19H.
What are the key properties of 1,5-dianilinopyridin-2-one?
1,5-dianilinopyridin-2-one has a molecular weight of 277.33 g/mol, XLogP of 3.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dianilinopyridin-2-one is sourced from PubChem (CID 56670211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).