C23H28N4 — CID 56670271
3-pentan-3-yl-7-[(2,4,6-trimethylphenyl)methyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 56670271) has the molecular formula C23H28N4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 3-pentan-3-yl-7-[(2,4,6-trimethylphenyl)methyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-pentan-3-yl-7-[(2,4,6-trimethylphenyl)methyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 56670271 |
| Molecular Formula | C23H28N4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 3-pentan-3-yl-7-[(2,4,6-trimethylphenyl)methyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CCC(CC)n1ccc2c(Cc3c(C)cc(C)cc3C)nc3ccnn3c21 |
| InChI | InChI=1S/C23H28N4/c1-6-18(7-2)26-11-9-19-21(25-22-8-10-24-27(22)23(19)26)14-20-16(4)12-15(3)13-17(20)5/h8-13,18H,6-7,14H2,1-5H3 |
| InChIKey | STZUQSKHHQPAIP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |