About 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide
4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide (PubChem CID 56670345) has the molecular formula C21H21NO4S
and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide.
Molecular Properties
| Compound Name | 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide |
| PubChem CID | 56670345 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide |
| SMILES | COc1cc(NS(=O)c2ccc(-c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H21NO4S/c1-24-19-13-17(14-20(25-2)21(19)26-3)22-27(23)18-11-9-16(10-12-18)15-7-5-4-6-8-15/h4-14,22H,1-3H3 |
| InChIKey | VNGVPVOWSARLEW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide?
The IUPAC name of 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide (CID 56670345) is 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide.
What is the SMILES notation for 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide?
The canonical SMILES for 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide is COc1cc(NS(=O)c2ccc(-c3ccccc3)cc2)cc(OC)c1OC.
What is the InChIKey of 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide?
The InChIKey is VNGVPVOWSARLEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO4S/c1-24-19-13-17(14-20(25-2)21(19)26-3)22-27(23)18-11-9-16(10-12-18)15-7-5-4-6-8-15/h4-14,22H,1-3H3.
What are the key properties of 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide?
4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide has a molecular weight of 383.47 g/mol, XLogP of 4.51, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-N-(3,4,5-trimethoxyphenyl)benzenesulfinamide is sourced from PubChem (CID 56670345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).