C17H19ClO6S — CID 56670358
(2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-hydroxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 56670358) has the molecular formula C17H19ClO6S and a molecular weight of 386.85 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-hydroxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-hydroxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56670358 |
| Molecular Formula | C17H19ClO6S |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[5-chloro-4-[(4-hydroxyphenyl)methyl]thiophen-2-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2cc(Cc3ccc(O)cc3)c(Cl)s2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H19ClO6S/c18-17-9(5-8-1-3-10(20)4-2-8)6-12(25-17)16-15(23)14(22)13(21)11(7-19)24-16/h1-4,6,11,13-16,19-23H,5,7H2/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | XDNHCWVUMFULBV-JZYAIQKZSA-N |
| XLogP | 1.21 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |