C22H32N4O5 — CID 56670435
2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3-methoxyphenyl)diazinane-1-carboxamide (PubChem CID 56670435) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3-methoxyphenyl)diazinane-1-carboxamide.
| Compound Name | 2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3-methoxyphenyl)diazinane-1-carboxamide |
|---|---|
| PubChem CID | 56670435 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 2-[(2R)-2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]-N-(3-methoxyphenyl)diazinane-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2CCCCN2C(=O)[C@H](CC2CCCC2)CN(O)C=O)c1 |
| InChI | InChI=1S/C22H32N4O5/c1-31-20-10-6-9-19(14-20)23-22(29)26-12-5-4-11-25(26)21(28)18(15-24(30)16-27)13-17-7-2-3-8-17/h6,9-10,14,16-18,30H,2-5,7-8,11-13,15H2,1H3,(H,23,29)/t18-/m1/s1 |
| InChIKey | ADDUSXGIWKFTBR-GOSISDBHSA-N |
| XLogP | 3.11 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|