C16H22F3N3O2 — CID 566712
2,2,6,6-tetramethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine (PubChem CID 566712) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine.
| Compound Name | 2,2,6,6-tetramethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 566712 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[2-nitro-4-(trifluoromethyl)phenyl]piperidin-4-amine |
| SMILES | CC1(C)CC(Nc2ccc(C(F)(F)F)cc2[N+](=O)[O-])CC(C)(C)N1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-14(2)8-11(9-15(3,4)21-14)20-12-6-5-10(16(17,18)19)7-13(12)22(23)24/h5-7,11,20-21H,8-9H2,1-4H3 |
| InChIKey | IJOBZIJWMKELRX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|