C21H18Cl2N2OSe — CID 56671790
(3R)-1,3-bis(4-chlorophenyl)-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one (PubChem CID 56671790) has the molecular formula C21H18Cl2N2OSe and a molecular weight of 464.25 g/mol. Its IUPAC name is (3R)-1,3-bis(4-chlorophenyl)-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one.
| Compound Name | (3R)-1,3-bis(4-chlorophenyl)-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 56671790 |
| Molecular Formula | C21H18Cl2N2OSe |
| Molecular Weight | 464.25 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | (3R)-1,3-bis(4-chlorophenyl)-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
| SMILES | O=C(C[C@@H](c1ccc(Cl)cc1)[C@@H]1CCCc2[se]nnc21)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N2OSe/c22-15-8-4-13(5-9-15)18(12-19(26)14-6-10-16(23)11-7-14)17-2-1-3-20-21(17)24-25-27-20/h4-11,17-18H,1-3,12H2/t17-,18-/m0/s1 |
| InChIKey | QZHUVKROOJOSSE-ROUUACIJSA-N |
| XLogP | 5.32 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.25 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|