C22H26F3N5O — CID 56672021
N-[1-(4-ethynylcyclohexyl)azetidin-3-yl]-2-[[1-methyl-5-(trifluoromethyl)indazol-3-yl]amino]acetamide (PubChem CID 56672021) has the molecular formula C22H26F3N5O and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[1-(4-ethynylcyclohexyl)azetidin-3-yl]-2-[[1-methyl-5-(trifluoromethyl)indazol-3-yl]amino]acetamide.
| Compound Name | N-[1-(4-ethynylcyclohexyl)azetidin-3-yl]-2-[[1-methyl-5-(trifluoromethyl)indazol-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 56672021 |
| Molecular Formula | C22H26F3N5O |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[1-(4-ethynylcyclohexyl)azetidin-3-yl]-2-[[1-methyl-5-(trifluoromethyl)indazol-3-yl]amino]acetamide |
| SMILES | C#CC1CCC(N2CC(NC(=O)CNc3nn(C)c4ccc(C(F)(F)F)cc34)C2)CC1 |
| InChI | InChI=1S/C22H26F3N5O/c1-3-14-4-7-17(8-5-14)30-12-16(13-30)27-20(31)11-26-21-18-10-15(22(23,24)25)6-9-19(18)29(2)28-21/h1,6,9-10,14,16-17H,4-5,7-8,11-13H2,2H3,(H,26,28)(H,27,31) |
| InChIKey | PSWNFJQWICYKCD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|