C25H29ClO7 — CID 56672120
(1S,10Z,15R,16S,17R,18R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,13,19-trioxatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,10-tetraene-16,17,18-triol (PubChem CID 56672120) has the molecular formula C25H29ClO7 and a molecular weight of 476.95 g/mol. Its IUPAC name is (1S,10Z,15R,16S,17R,18R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,13,19-trioxatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,10-tetraene-16,17,18-triol.
| Compound Name | (1S,10Z,15R,16S,17R,18R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,13,19-trioxatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,10-tetraene-16,17,18-triol |
|---|---|
| PubChem CID | 56672120 |
| Molecular Formula | C25H29ClO7 |
| Molecular Weight | 476.95 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (1S,10Z,15R,16S,17R,18R)-5-chloro-4-[(4-ethoxyphenyl)methyl]-8,13,19-trioxatricyclo[13.3.1.02,7]nonadeca-2(7),3,5,10-tetraene-16,17,18-triol |
| SMILES | CCOc1ccc(Cc2cc3c(cc2Cl)OC/C=C\COC[C@H]2O[C@@H]3[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C25H29ClO7/c1-2-31-17-7-5-15(6-8-17)11-16-12-18-20(13-19(16)26)32-10-4-3-9-30-14-21-22(27)23(28)24(29)25(18)33-21/h3-8,12-13,21-25,27-29H,2,9-11,14H2,1H3/b4-3-/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | BFJWSYSBSKFPOC-IHBIINJRSA-N |
| XLogP | 2.82 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.95 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|