C22H23NaO3S — CID 56672143
sodium 2-[2-(4-methylsulfanylphenyl)-4-[(2-oxocyclopentyl)methyl]phenyl]propanoate (PubChem CID 56672143) has the molecular formula C22H23NaO3S and a molecular weight of 390.48 g/mol. Its IUPAC name is sodium 2-[2-(4-methylsulfanylphenyl)-4-[(2-oxocyclopentyl)methyl]phenyl]propanoate.
| Compound Name | sodium 2-[2-(4-methylsulfanylphenyl)-4-[(2-oxocyclopentyl)methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 56672143 |
| Molecular Formula | C22H23NaO3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | sodium 2-[2-(4-methylsulfanylphenyl)-4-[(2-oxocyclopentyl)methyl]phenyl]propanoate |
| SMILES | CSc1ccc(-c2cc(CC3CCCC3=O)ccc2C(C)C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C22H24O3S.Na/c1-14(22(24)25)19-11-6-15(12-17-4-3-5-21(17)23)13-20(19)16-7-9-18(26-2)10-8-16;/h6-11,13-14,17H,3-5,12H2,1-2H3,(H,24,25);/q;+1/p-1 |
| InChIKey | HOCZATUSNAWMHR-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |