C18H17F4N3O2 — CID 56672584
(NZ)-N-[(2,5-dimethylpyrrolidin-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 56672584) has the molecular formula C18H17F4N3O2 and a molecular weight of 383.35 g/mol. Its IUPAC name is (NZ)-N-[(2,5-dimethylpyrrolidin-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2,5-dimethylpyrrolidin-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 56672584 |
| Molecular Formula | C18H17F4N3O2 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (NZ)-N-[(2,5-dimethylpyrrolidin-1-yl)-[6-(2,3,5,6-tetrafluorophenoxy)-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | CC1CCC(C)N1/C(=N\O)c1ccc(Oc2c(F)c(F)cc(F)c2F)nc1 |
| InChI | InChI=1S/C18H17F4N3O2/c1-9-3-4-10(2)25(9)18(24-26)11-5-6-14(23-8-11)27-17-15(21)12(19)7-13(20)16(17)22/h5-10,26H,3-4H2,1-2H3/b24-18- |
| InChIKey | JATKCEUJYRAYHD-MOHJPFBDSA-N |
| XLogP | 4.44 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|